Ouabain

Formula:
C29H44O12
CAS Number(s):
630-60-4
SMILES code:

OC[C@]12[C@H](O)C[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)C[C@]2(O) CC[C@@H]2C1[C@H](O)C[C@@]1(C)[C@H](CC[C@@]21O)C1=CC(=O)OC1

Stoichiometry:
2/1
Source:
Pharm Eu 6.2
Powder Spectrum DOI(s):
10.1002/jps.3030481008